C14H17ClN4O5 — CID 9224659
4-chloro-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 9224659) has the molecular formula C14H17ClN4O5 and a molecular weight of 356.77 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9224659 |
| Molecular Formula | C14H17ClN4O5 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-chloro-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | CCNC(=O)CNC(=O)[C@H](C)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17ClN4O5/c1-3-16-12(20)7-17-13(21)8(2)18-14(22)9-4-5-10(15)11(6-9)19(23)24/h4-6,8H,3,7H2,1-2H3,(H,16,20)(H,17,21)(H,18,22)/t8-/m0/s1 |
| InChIKey | DBZDUILGSFKAAI-QMMMGPOBSA-N |
| XLogP | 0.62 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|