C18H25ClN4O5 — CID 9227826
4-chloro-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]butan-2-yl]-3-nitrobenzamide (PubChem CID 9227826) has the molecular formula C18H25ClN4O5 and a molecular weight of 412.87 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]butan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]butan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9227826 |
| Molecular Formula | C18H25ClN4O5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-chloro-N-[(2S)-3-methyl-1-oxo-1-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]butan-2-yl]-3-nitrobenzamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)[C@@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C18H25ClN4O5/c1-5-8-20-16(24)11(4)21-18(26)15(10(2)3)22-17(25)12-6-7-13(19)14(9-12)23(27)28/h6-7,9-11,15H,5,8H2,1-4H3,(H,20,24)(H,21,26)(H,22,25)/t11-,15+/m1/s1 |
| InChIKey | RJAPXLSXEUXCRQ-ABAIWWIYSA-N |
| XLogP | 2.03 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|