C14H16ClN3O6 — CID 7571686
(2-amino-2-oxoethyl) (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 7571686) has the molecular formula C14H16ClN3O6 and a molecular weight of 357.75 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2-amino-2-oxoethyl) (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7571686 |
| Molecular Formula | C14H16ClN3O6 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (2-amino-2-oxoethyl) (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCC(N)=O |
| InChI | InChI=1S/C14H16ClN3O6/c1-7(2)12(14(21)24-6-11(16)19)17-13(20)8-3-4-9(15)10(5-8)18(22)23/h3-5,7,12H,6H2,1-2H3,(H2,16,19)(H,17,20)/t12-/m0/s1 |
| InChIKey | ZNRJMFDOWFWTOZ-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|