C21H20ClF2N3O7 — CID 55926564
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55926564) has the molecular formula C21H20ClF2N3O7 and a molecular weight of 499.85 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55926564 |
| Molecular Formula | C21H20ClF2N3O7 |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C21H20ClF2N3O7/c1-11(2)18(26-19(29)12-7-8-13(22)15(9-12)27(31)32)20(30)33-10-17(28)25-14-5-3-4-6-16(14)34-21(23)24/h3-9,11,18,21H,10H2,1-2H3,(H,25,28)(H,26,29)/t18-/m0/s1 |
| InChIKey | UEVPQIWXQCNHEX-SFHVURJKSA-N |
| XLogP | 3.79 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|