C22H22ClN3O8 — CID 55306876
methyl 4-[[2-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzoate (PubChem CID 55306876) has the molecular formula C22H22ClN3O8 and a molecular weight of 491.88 g/mol. Its IUPAC name is methyl 4-[[2-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 55306876 |
| Molecular Formula | C22H22ClN3O8 |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | methyl 4-[[2-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)C(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(C)C)cc1 |
| InChI | InChI=1S/C22H22ClN3O8/c1-12(2)19(25-20(28)14-6-9-16(23)17(10-14)26(31)32)22(30)34-11-18(27)24-15-7-4-13(5-8-15)21(29)33-3/h4-10,12,19H,11H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | PJMHYTWEVFUHIO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|