C16H13F2N3O6 — CID 7781439
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 7781439) has the molecular formula C16H13F2N3O6 and a molecular weight of 381.29 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7781439 |
| Molecular Formula | C16H13F2N3O6 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)Nc2ccccc2OC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13F2N3O6/c17-16(18)27-13-4-2-1-3-11(13)20-14(22)8-26-15(23)9-5-6-10(19)12(7-9)21(24)25/h1-7,16H,8,19H2,(H,20,22) |
| InChIKey | HXMPLMDDYVNKOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|