C21H21F2N3O6 — CID 46792973
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-nitro-2-piperidin-1-ylbenzoate (PubChem CID 46792973) has the molecular formula C21H21F2N3O6 and a molecular weight of 449.41 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-nitro-2-piperidin-1-ylbenzoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-nitro-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 46792973 |
| Molecular Formula | C21H21F2N3O6 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-nitro-2-piperidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCCC1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C21H21F2N3O6/c22-21(23)32-18-7-3-2-6-16(18)24-19(27)13-31-20(28)15-12-14(26(29)30)8-9-17(15)25-10-4-1-5-11-25/h2-3,6-9,12,21H,1,4-5,10-11,13H2,(H,24,27) |
| InChIKey | JWZOMIDWFDHBDX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|