C21H22ClN3O6 — CID 35777374
[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 35777374) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 35777374 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C21H22ClN3O6/c1-13-9-17(19(30-2)11-16(13)22)23-20(26)12-31-21(27)15-10-14(25(28)29)5-6-18(15)24-7-3-4-8-24/h5-6,9-11H,3-4,7-8,12H2,1-2H3,(H,23,26) |
| InChIKey | KKOOCGZFCHIJTN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|