C21H18Cl2N4O6 — CID 55306833
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55306833) has the molecular formula C21H18Cl2N4O6 and a molecular weight of 493.30 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55306833 |
| Molecular Formula | C21H18Cl2N4O6 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H18Cl2N4O6/c1-11(2)18(24-19(28)13-5-8-15(23)16(9-13)27(30)31)21(29)32-10-17-25-26-20(33-17)12-3-6-14(22)7-4-12/h3-9,11,18H,10H2,1-2H3,(H,24,28) |
| InChIKey | JIAFAQTWIFGRBC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|