C21H20Cl2N2O7 — CID 55928346
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55928346) has the molecular formula C21H20Cl2N2O7 and a molecular weight of 483.30 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55928346 |
| Molecular Formula | C21H20Cl2N2O7 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (2S)-2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C21H20Cl2N2O7/c1-11(2)18(24-20(26)12-3-4-16(23)17(7-12)25(28)29)21(27)31-9-14-6-15(22)5-13-8-30-10-32-19(13)14/h3-7,11,18H,8-10H2,1-2H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | ROFHPGZLQAEDEM-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|