C20H20ClN3O6 — CID 55334776
N-[1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide (PubChem CID 55334776) has the molecular formula C20H20ClN3O6 and a molecular weight of 433.85 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 55334776 |
| Molecular Formula | C20H20ClN3O6 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20ClN3O6/c1-11(2)18(23-19(25)13-4-5-14(21)15(8-13)24(27)28)20(26)22-9-12-3-6-16-17(7-12)30-10-29-16/h3-8,11,18H,9-10H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | GRKUXXWNSDGZBF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|