C30H36N2O4 — CID 92654622
4-(1-adamantyl)-N-[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 92654622) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-(1-adamantyl)-N-[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(1-adamantyl)-N-[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 92654622 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 4-(1-adamantyl)-N-[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H36N2O4/c1-18(2)27(29(34)31-16-19-3-8-25-26(12-19)36-17-35-25)32-28(33)23-4-6-24(7-5-23)30-13-20-9-21(14-30)11-22(10-20)15-30/h3-8,12,18,20-22,27H,9-11,13-17H2,1-2H3,(H,31,34)(H,32,33)/t20?,21?,22?,27-,30?/m1/s1 |
| InChIKey | YPDZWNCZQBCJGO-HZKFARACSA-N |
| XLogP | 4.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |