C24H31N3O5 — CID 17478620
N-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide (PubChem CID 17478620) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 17478620 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
| SMILES | CC(C)C(NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H31N3O5/c1-13(2)20(25-23(30)24-9-14-5-15(10-24)7-16(6-14)11-24)22(29)27-26-21(28)17-3-4-18-19(8-17)32-12-31-18/h3-4,8,13-16,20H,5-7,9-12H2,1-2H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | GAHWBQFXQKKVAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|