C27H40N2O3 — CID 46505966
4-(1-adamantyl)-N-[1-(3-ethoxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 46505966) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 4-(1-adamantyl)-N-[1-(3-ethoxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(1-adamantyl)-N-[1-(3-ethoxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 46505966 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 4-(1-adamantyl)-N-[1-(3-ethoxypropylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCOCCCNC(=O)C(NC(=O)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C(C)C |
| InChI | InChI=1S/C27H40N2O3/c1-4-32-11-5-10-28-26(31)24(18(2)3)29-25(30)22-6-8-23(9-7-22)27-15-19-12-20(16-27)14-21(13-19)17-27/h6-9,18-21,24H,4-5,10-17H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | SDUVMCDOFSLGEN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|