C25H36N2O3 — CID 18120290
N-[3-methyl-1-oxo-1-(3-phenoxypropylamino)butan-2-yl]adamantane-1-carboxamide (PubChem CID 18120290) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-(3-phenoxypropylamino)butan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[3-methyl-1-oxo-1-(3-phenoxypropylamino)butan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18120290 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[3-methyl-1-oxo-1-(3-phenoxypropylamino)butan-2-yl]adamantane-1-carboxamide |
| SMILES | CC(C)C(NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NCCCOc1ccccc1 |
| InChI | InChI=1S/C25H36N2O3/c1-17(2)22(23(28)26-9-6-10-30-21-7-4-3-5-8-21)27-24(29)25-14-18-11-19(15-25)13-20(12-18)16-25/h3-5,7-8,17-20,22H,6,9-16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | SKGOPQPQEZCHKP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|