C21H34N2O4 — CID 119234600
5-[[2-(adamantane-1-carbonylamino)-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 119234600) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 5-[[2-(adamantane-1-carbonylamino)-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(adamantane-1-carbonylamino)-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234600 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 5-[[2-(adamantane-1-carbonylamino)-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C21H34N2O4/c1-13(2)18(19(26)22-6-4-3-5-17(24)25)23-20(27)21-10-14-7-15(11-21)9-16(8-14)12-21/h13-16,18H,3-12H2,1-2H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | FFRFZUPWJPJULV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|