C24H38N4O6 — CID 2755415
4-[2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid (PubChem CID 2755415) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2755415 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 4-[2-[5-(adamantane-1-carbonylamino)pentanoylamino]propanoylamino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(NC(=O)CCCCNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NC(CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C24H38N4O6/c1-14(22(33)28-18(21(25)32)5-6-20(30)31)27-19(29)4-2-3-7-26-23(34)24-11-15-8-16(12-24)10-17(9-15)13-24/h14-18H,2-13H2,1H3,(H2,25,32)(H,26,34)(H,27,29)(H,28,33)(H,30,31) |
| InChIKey | MAXISSRPUJZKHT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|