C14H26N4O4 — CID 173333706
(2R)-2-[[(2S)-2-aminopropanoyl]amino]-N'-(6-oxohexyl)pentanediamide (PubChem CID 173333706) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-aminopropanoyl]amino]-N'-(6-oxohexyl)pentanediamide.
| Compound Name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]-N'-(6-oxohexyl)pentanediamide |
|---|---|
| PubChem CID | 173333706 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]-N'-(6-oxohexyl)pentanediamide |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)NCCCCCC=O)C(N)=O |
| InChI | InChI=1S/C14H26N4O4/c1-10(15)14(22)18-11(13(16)21)6-7-12(20)17-8-4-2-3-5-9-19/h9-11H,2-8,15H2,1H3,(H2,16,21)(H,17,20)(H,18,22)/t10-,11+/m0/s1 |
| InChIKey | LWPFJAIOMUULDK-WDEREUQCSA-N |
| XLogP | -1.04 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|