C14H30N6O3 — CID 59839930
(2S)-2-[[(2R)-2-amino-5-(methylamino)pentanoyl]amino]-N'-[2-(methylamino)ethyl]pentanediamide (PubChem CID 59839930) has the molecular formula C14H30N6O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-5-(methylamino)pentanoyl]amino]-N'-[2-(methylamino)ethyl]pentanediamide.
| Compound Name | (2S)-2-[[(2R)-2-amino-5-(methylamino)pentanoyl]amino]-N'-[2-(methylamino)ethyl]pentanediamide |
|---|---|
| PubChem CID | 59839930 |
| Molecular Formula | C14H30N6O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-5-(methylamino)pentanoyl]amino]-N'-[2-(methylamino)ethyl]pentanediamide |
| SMILES | CNCCC[C@@H](N)C(=O)N[C@@H](CCC(=O)NCCNC)C(N)=O |
| InChI | InChI=1S/C14H30N6O3/c1-17-7-3-4-10(15)14(23)20-11(13(16)22)5-6-12(21)19-9-8-18-2/h10-11,17-18H,3-9,15H2,1-2H3,(H2,16,22)(H,19,21)(H,20,23)/t10-,11+/m1/s1 |
| InChIKey | MOPJJSFOUYTEJE-MNOVXSKESA-N |
| XLogP | -2.60 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|