C12H31N3OS — CID 144745680
(2S)-2-amino-5-(methylamino)-N-(2-sulfanylethyl)pentanamide;ethane (PubChem CID 144745680) has the molecular formula C12H31N3OS and a molecular weight of 265.47 g/mol. Its IUPAC name is (2S)-2-amino-5-(methylamino)-N-(2-sulfanylethyl)pentanamide;ethane.
| Compound Name | (2S)-2-amino-5-(methylamino)-N-(2-sulfanylethyl)pentanamide;ethane |
|---|---|
| PubChem CID | 144745680 |
| Molecular Formula | C12H31N3OS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2S)-2-amino-5-(methylamino)-N-(2-sulfanylethyl)pentanamide;ethane |
| SMILES | CC.CC.CNCCC[C@H](N)C(=O)NCCS |
| InChI | InChI=1S/C8H19N3OS.2C2H6/c1-10-4-2-3-7(9)8(12)11-5-6-13;2*1-2/h7,10,13H,2-6,9H2,1H3,(H,11,12);2*1-2H3/t7-;;/m0../s1 |
| InChIKey | YZYULOAVYYSSPV-KLXURFKVSA-N |
| XLogP | 1.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|