C10H24N4O — CID 59831421
(2S)-2,5-bis(methylamino)-N-[2-(methylamino)ethyl]pentanamide (PubChem CID 59831421) has the molecular formula C10H24N4O and a molecular weight of 216.33 g/mol. Its IUPAC name is (2S)-2,5-bis(methylamino)-N-[2-(methylamino)ethyl]pentanamide.
| Compound Name | (2S)-2,5-bis(methylamino)-N-[2-(methylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 59831421 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | (2S)-2,5-bis(methylamino)-N-[2-(methylamino)ethyl]pentanamide |
| SMILES | CNCCC[C@H](NC)C(=O)NCCNC |
| InChI | InChI=1S/C10H24N4O/c1-11-6-4-5-9(13-3)10(15)14-8-7-12-2/h9,11-13H,4-8H2,1-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | WXKYIDBSHGWGNN-VIFPVBQESA-N |
| XLogP | -1.09 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|