C10H22N4O2 — CID 166964502
6-(methylamino)-2-(2-methylhydrazinyl)-N-(2-oxoethyl)hexanamide (PubChem CID 166964502) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-(methylamino)-2-(2-methylhydrazinyl)-N-(2-oxoethyl)hexanamide.
| Compound Name | 6-(methylamino)-2-(2-methylhydrazinyl)-N-(2-oxoethyl)hexanamide |
|---|---|
| PubChem CID | 166964502 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 6-(methylamino)-2-(2-methylhydrazinyl)-N-(2-oxoethyl)hexanamide |
| SMILES | CNCCCCC(NNC)C(=O)NCC=O |
| InChI | InChI=1S/C10H22N4O2/c1-11-6-4-3-5-9(14-12-2)10(16)13-7-8-15/h8-9,11-12,14H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | ZAXOJOPQASWROE-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|