C10H22N4O2 — CID 58661389
N-(2-amino-2-oxoethyl)-2,6-bis(methylamino)hexanamide (PubChem CID 58661389) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,6-bis(methylamino)hexanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,6-bis(methylamino)hexanamide |
|---|---|
| PubChem CID | 58661389 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,6-bis(methylamino)hexanamide |
| SMILES | CNCCCCC(NC)C(=O)NCC(N)=O |
| InChI | InChI=1S/C10H22N4O2/c1-12-6-4-3-5-8(13-2)10(16)14-7-9(11)15/h8,12-13H,3-7H2,1-2H3,(H2,11,15)(H,14,16) |
| InChIKey | AYJQPDKNSZRPJY-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|