C18H40N4O2 — CID 91227284
(3R)-3,7-bis(methylamino)heptan-2-one (PubChem CID 91227284) has the molecular formula C18H40N4O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (3R)-3,7-bis(methylamino)heptan-2-one.
| Compound Name | (3R)-3,7-bis(methylamino)heptan-2-one |
|---|---|
| PubChem CID | 91227284 |
| Molecular Formula | C18H40N4O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | (3R)-3,7-bis(methylamino)heptan-2-one |
| SMILES | CNCCCC[C@@H](NC)C(C)=O.CNCCCC[C@@H](NC)C(C)=O |
| InChI | InChI=1S/2C9H20N2O/c2*1-8(12)9(11-3)6-4-5-7-10-2/h2*9-11H,4-7H2,1-3H3/t2*9-/m11/s1 |
| InChIKey | NSAZCXRZNSUKQL-USJXWOKUSA-N |
| XLogP | 1.11 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|