C14H30N2O2 — CID 159495091
2,2-dimethyl-N-[5-(methylamino)-6-oxoheptyl]propanamide;methane (PubChem CID 159495091) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-(methylamino)-6-oxoheptyl]propanamide;methane.
| Compound Name | 2,2-dimethyl-N-[5-(methylamino)-6-oxoheptyl]propanamide;methane |
|---|---|
| PubChem CID | 159495091 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2,2-dimethyl-N-[5-(methylamino)-6-oxoheptyl]propanamide;methane |
| SMILES | C.CNC(CCCCNC(=O)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C13H26N2O2.CH4/c1-10(16)11(14-5)8-6-7-9-15-12(17)13(2,3)4;/h11,14H,6-9H2,1-5H3,(H,15,17);1H4 |
| InChIKey | LYRIXZPFAKQIIU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|