C19H38N2O4 — CID 171600339
3-[2-(3,3-dimethylbutoxy)ethoxy]-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide (PubChem CID 171600339) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-[2-(3,3-dimethylbutoxy)ethoxy]-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide.
| Compound Name | 3-[2-(3,3-dimethylbutoxy)ethoxy]-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide |
|---|---|
| PubChem CID | 171600339 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 3-[2-(3,3-dimethylbutoxy)ethoxy]-N-[(5S)-5-(methylamino)-6-oxoheptyl]propanamide |
| SMILES | CN[C@@H](CCCCNC(=O)CCOCCOCCC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C19H38N2O4/c1-16(22)17(20-5)8-6-7-11-21-18(23)9-12-24-14-15-25-13-10-19(2,3)4/h17,20H,6-15H2,1-5H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | CWDFGUPEJQAWEI-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|