C25H41N3O5 — CID 163386284
N-[2-[2-[2-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethyl]-4-(4-methylphenyl)butanamide (PubChem CID 163386284) has the molecular formula C25H41N3O5 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-[2-[2-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethyl]-4-(4-methylphenyl)butanamide.
| Compound Name | N-[2-[2-[2-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethyl]-4-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 163386284 |
| Molecular Formula | C25H41N3O5 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | N-[2-[2-[2-[[(5S)-5-(methylamino)-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethyl]-4-(4-methylphenyl)butanamide |
| SMILES | CN[C@@H](CCCCNC(=O)COCCOCCNC(=O)CCCc1ccc(C)cc1)C(C)=O |
| InChI | InChI=1S/C25H41N3O5/c1-20-10-12-22(13-11-20)7-6-9-24(30)28-15-16-32-17-18-33-19-25(31)27-14-5-4-8-23(26-3)21(2)29/h10-13,23,26H,4-9,14-19H2,1-3H3,(H,27,31)(H,28,30)/t23-/m0/s1 |
| InChIKey | NRXNGIWJLLUKJC-QHCPKHFHSA-N |
| XLogP | 1.93 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|