C20H33NO3 — CID 162728508
ethane;2-methyl-6-[4-(4-methylphenyl)butanoylamino]hexanoic acid (PubChem CID 162728508) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is ethane;2-methyl-6-[4-(4-methylphenyl)butanoylamino]hexanoic acid.
| Compound Name | ethane;2-methyl-6-[4-(4-methylphenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 162728508 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | ethane;2-methyl-6-[4-(4-methylphenyl)butanoylamino]hexanoic acid |
| SMILES | CC.Cc1ccc(CCCC(=O)NCCCCC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H27NO3.C2H6/c1-14-9-11-16(12-10-14)7-5-8-17(20)19-13-4-3-6-15(2)18(21)22;1-2/h9-12,15H,3-8,13H2,1-2H3,(H,19,20)(H,21,22);1-2H3 |
| InChIKey | RYUCKYMALSNRAC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|