C26H47N3O2 — CID 171639484
ethane;2-[4-(4-methylphenyl)butanoylamino]-N-pentyl-5-(propan-2-ylamino)pentanamide (PubChem CID 171639484) has the molecular formula C26H47N3O2 and a molecular weight of 433.68 g/mol. Its IUPAC name is ethane;2-[4-(4-methylphenyl)butanoylamino]-N-pentyl-5-(propan-2-ylamino)pentanamide.
| Compound Name | ethane;2-[4-(4-methylphenyl)butanoylamino]-N-pentyl-5-(propan-2-ylamino)pentanamide |
|---|---|
| PubChem CID | 171639484 |
| Molecular Formula | C26H47N3O2 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.37 |
| IUPAC Name | ethane;2-[4-(4-methylphenyl)butanoylamino]-N-pentyl-5-(propan-2-ylamino)pentanamide |
| SMILES | CC.CCCCCNC(=O)C(CCCNC(C)C)NC(=O)CCCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H41N3O2.C2H6/c1-5-6-7-17-26-24(29)22(11-9-18-25-19(2)3)27-23(28)12-8-10-21-15-13-20(4)14-16-21;1-2/h13-16,19,22,25H,5-12,17-18H2,1-4H3,(H,26,29)(H,27,28);1-2H3 |
| InChIKey | RCCLAIUNGVKYGV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|