C31H48IN5O8 — CID 171064970
5-[[1-carboxy-3-oxo-3-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]propyl]amino]-4-[4-(4-iodophenyl)butanoylamino]-5-oxopentanoic acid (PubChem CID 171064970) has the molecular formula C31H48IN5O8 and a molecular weight of 745.66 g/mol. Its IUPAC name is 5-[[1-carboxy-3-oxo-3-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]propyl]amino]-4-[4-(4-iodophenyl)butanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-3-oxo-3-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]propyl]amino]-4-[4-(4-iodophenyl)butanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 171064970 |
| Molecular Formula | C31H48IN5O8 |
| Molecular Weight | 745.66 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | 5-[[1-carboxy-3-oxo-3-[[1-oxo-1,6-bis(propan-2-ylamino)hexan-2-yl]amino]propyl]amino]-4-[4-(4-iodophenyl)butanoylamino]-5-oxopentanoic acid |
| SMILES | CC(C)NCCCCC(NC(=O)CC(NC(=O)C(CCC(=O)O)NC(=O)CCCc1ccc(I)cc1)C(=O)O)C(=O)NC(C)C |
| InChI | InChI=1S/C31H48IN5O8/c1-19(2)33-17-6-5-9-23(29(42)34-20(3)4)36-27(39)18-25(31(44)45)37-30(43)24(15-16-28(40)41)35-26(38)10-7-8-21-11-13-22(32)14-12-21/h11-14,19-20,23-25,33H,5-10,15-18H2,1-4H3,(H,34,42)(H,35,38)(H,36,39)(H,37,43)(H,40,41)(H,44,45) |
| InChIKey | ZBGNUTXRFKQOFF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 203.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|