C25H38IN3O6 — CID 170325268
6-amino-2-[[2-[4-(4-iodophenyl)butanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 170325268) has the molecular formula C25H38IN3O6 and a molecular weight of 603.50 g/mol. Its IUPAC name is 6-amino-2-[[2-[4-(4-iodophenyl)butanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[4-(4-iodophenyl)butanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 170325268 |
| Molecular Formula | C25H38IN3O6 |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 6-amino-2-[[2-[4-(4-iodophenyl)butanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)CCCc1ccc(I)cc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C25H38IN3O6/c1-25(2,3)35-22(31)15-14-19(23(32)29-20(24(33)34)8-4-5-16-27)28-21(30)9-6-7-17-10-12-18(26)13-11-17/h10-13,19-20H,4-9,14-16,27H2,1-3H3,(H,28,30)(H,29,32)(H,33,34) |
| InChIKey | ORMOBNPTHVTZPR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|