C32H52IN3O8Si — CID 150162166
methyl (2S)-6-[4-(4-iodophenyl)butanoylamino]-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]hexanoate (PubChem CID 150162166) has the molecular formula C32H52IN3O8Si and a molecular weight of 761.77 g/mol. Its IUPAC name is methyl (2S)-6-[4-(4-iodophenyl)butanoylamino]-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-[4-(4-iodophenyl)butanoylamino]-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 150162166 |
| Molecular Formula | C32H52IN3O8Si |
| Molecular Weight | 761.77 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | methyl (2S)-6-[4-(4-iodophenyl)butanoylamino]-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)CCCc1ccc(I)cc1)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C32H52IN3O8Si/c1-32(2,3)44-28(38)19-18-25(36-31(41)43-21-22-45(5,6)7)29(39)35-26(30(40)42-4)12-8-9-20-34-27(37)13-10-11-23-14-16-24(33)17-15-23/h14-17,25-26H,8-13,18-22H2,1-7H3,(H,34,37)(H,35,39)(H,36,41)/t25-,26-/m0/s1 |
| InChIKey | FHRCBBYUQFYKJK-UIOOFZCWSA-N |
| XLogP | 5.11 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|