C21H39N3O7 — CID 170538910
methyl (2R)-2-[[(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 170538910) has the molecular formula C21H39N3O7 and a molecular weight of 445.56 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2R)-2-[[(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 170538910 |
| Molecular Formula | C21H39N3O7 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | methyl (2R)-2-[[(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)OC(C)(C)C)NC(=O)[C@H](N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N3O7/c1-20(2,3)30-16(25)12-11-14(22)17(26)24-15(18(27)29-7)10-8-9-13-23-19(28)31-21(4,5)6/h14-15H,8-13,22H2,1-7H3,(H,23,28)(H,24,26)/t14-,15-/m1/s1 |
| InChIKey | DUVYQWLKUQFRDU-HUUCEWRRSA-N |
| XLogP | 1.79 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|