C26H40IN3O6 — CID 139557098
methyl (2S)-2-[[(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoate (PubChem CID 139557098) has the molecular formula C26H40IN3O6 and a molecular weight of 617.53 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoate |
|---|---|
| PubChem CID | 139557098 |
| Molecular Formula | C26H40IN3O6 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-[4-(4-iodophenyl)butanoylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)CCCc1ccc(I)cc1)NC(=O)[C@@H](N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40IN3O6/c1-26(2,3)36-23(32)16-15-20(28)24(33)30-21(25(34)35-4)9-5-6-17-29-22(31)10-7-8-18-11-13-19(27)14-12-18/h11-14,20-21H,5-10,15-17,28H2,1-4H3,(H,29,31)(H,30,33)/t20-,21-/m0/s1 |
| InChIKey | FSITXDYFKIQERB-SFTDATJTSA-N |
| XLogP | 3.01 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|