C17H25IN2O3 — CID 175318185
methyl (2S)-6-amino-2-[4-(4-iodophenyl)butanoylamino]hexanoate (PubChem CID 175318185) has the molecular formula C17H25IN2O3 and a molecular weight of 432.30 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[4-(4-iodophenyl)butanoylamino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[4-(4-iodophenyl)butanoylamino]hexanoate |
|---|---|
| PubChem CID | 175318185 |
| Molecular Formula | C17H25IN2O3 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | methyl (2S)-6-amino-2-[4-(4-iodophenyl)butanoylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)CCCc1ccc(I)cc1 |
| InChI | InChI=1S/C17H25IN2O3/c1-23-17(22)15(6-2-3-12-19)20-16(21)7-4-5-13-8-10-14(18)11-9-13/h8-11,15H,2-7,12,19H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | MDLXORDYTSKBCE-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|