C17H24N2O5 — CID 91067270
methyl (2S)-5-(hydroxyamino)-2-[4-(4-methylphenyl)butanoylamino]-5-oxopentanoate (PubChem CID 91067270) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl (2S)-5-(hydroxyamino)-2-[4-(4-methylphenyl)butanoylamino]-5-oxopentanoate.
| Compound Name | methyl (2S)-5-(hydroxyamino)-2-[4-(4-methylphenyl)butanoylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 91067270 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl (2S)-5-(hydroxyamino)-2-[4-(4-methylphenyl)butanoylamino]-5-oxopentanoate |
| SMILES | COC(=O)[C@H](CCC(=O)NO)NC(=O)CCCc1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-12-6-8-13(9-7-12)4-3-5-15(20)18-14(17(22)24-2)10-11-16(21)19-23/h6-9,14,23H,3-5,10-11H2,1-2H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | LMMLNFDEKXDAQQ-AWEZNQCLSA-N |
| XLogP | 1.26 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|