C17H27N3O4 — CID 177315880
methyl 5-(methylamino)-2-[[2-(methylamino)acetyl]amino]-5-oxopentanoate;toluene (PubChem CID 177315880) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 5-(methylamino)-2-[[2-(methylamino)acetyl]amino]-5-oxopentanoate;toluene.
| Compound Name | methyl 5-(methylamino)-2-[[2-(methylamino)acetyl]amino]-5-oxopentanoate;toluene |
|---|---|
| PubChem CID | 177315880 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | methyl 5-(methylamino)-2-[[2-(methylamino)acetyl]amino]-5-oxopentanoate;toluene |
| SMILES | CNCC(=O)NC(CCC(=O)NC)C(=O)OC.Cc1ccccc1 |
| InChI | InChI=1S/C10H19N3O4.C7H8/c1-11-6-9(15)13-7(10(16)17-3)4-5-8(14)12-2;1-7-5-3-2-4-6-7/h7,11H,4-6H2,1-3H3,(H,12,14)(H,13,15);2-6H,1H3 |
| InChIKey | QZXPZELBNOGNCV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |