About methyl 2-methyl-3-oxopropanoate;toluene
methyl 2-methyl-3-oxopropanoate;toluene (PubChem CID 143054550) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 2-methyl-3-oxopropanoate;toluene.
Molecular Properties
| Compound Name | methyl 2-methyl-3-oxopropanoate;toluene |
| PubChem CID | 143054550 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl 2-methyl-3-oxopropanoate;toluene |
| SMILES | COC(=O)C(C)C=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C5H8O3/c1-7-5-3-2-4-6-7;1-4(3-6)5(7)8-2/h2-6H,1H3;3-4H,1-2H3 |
| InChIKey | SEBNGCBGLRPNEO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-3-oxopropanoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-oxopropanoate;toluene?
The IUPAC name of methyl 2-methyl-3-oxopropanoate;toluene (CID 143054550) is methyl 2-methyl-3-oxopropanoate;toluene.
What is the SMILES notation for methyl 2-methyl-3-oxopropanoate;toluene?
The canonical SMILES for methyl 2-methyl-3-oxopropanoate;toluene is COC(=O)C(C)C=O.Cc1ccccc1.
What is the InChIKey of methyl 2-methyl-3-oxopropanoate;toluene?
The InChIKey is SEBNGCBGLRPNEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C5H8O3/c1-7-5-3-2-4-6-7;1-4(3-6)5(7)8-2/h2-6H,1H3;3-4H,1-2H3.
What are the key properties of methyl 2-methyl-3-oxopropanoate;toluene?
methyl 2-methyl-3-oxopropanoate;toluene has a molecular weight of 208.26 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-oxopropanoate;toluene is sourced from PubChem (CID 143054550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).