C20H28N2O5 — CID 90686140
ethyl (2S)-5-(hydroxyamino)-2-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]-5-oxopentanoate (PubChem CID 90686140) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is ethyl (2S)-5-(hydroxyamino)-2-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]-5-oxopentanoate.
| Compound Name | ethyl (2S)-5-(hydroxyamino)-2-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 90686140 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl (2S)-5-(hydroxyamino)-2-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]-5-oxopentanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)NO)NC(=O)C1(c2ccc(C)cc2)CCCC1 |
| InChI | InChI=1S/C20H28N2O5/c1-3-27-18(24)16(10-11-17(23)22-26)21-19(25)20(12-4-5-13-20)15-8-6-14(2)7-9-15/h6-9,16,26H,3-5,10-13H2,1-2H3,(H,21,25)(H,22,23)/t16-/m0/s1 |
| InChIKey | WEYDSRKYGORZFI-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|