C19H27NO4 — CID 119363993
(2R)-4-methyl-2-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]pentanoic acid (PubChem CID 119363993) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119363993 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R)-4-methyl-2-[[4-(4-methylphenyl)oxane-4-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(C2(C(=O)N[C@H](CC(C)C)C(=O)O)CCOCC2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-13(2)12-16(17(21)22)20-18(23)19(8-10-24-11-9-19)15-6-4-14(3)5-7-15/h4-7,13,16H,8-12H2,1-3H3,(H,20,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | LZOPAZUMQGOVGP-MRXNPFEDSA-N |
| XLogP | 2.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |