C22H27NO2 — CID 100771023
N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-4-phenyloxane-4-carboxamide (PubChem CID 100771023) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 100771023 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-4-phenyloxane-4-carboxamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)C2(c3ccccc3)CCOCC2)cc1C |
| InChI | InChI=1S/C22H27NO2/c1-16-9-10-19(15-17(16)2)18(3)23-21(24)22(11-13-25-14-12-22)20-7-5-4-6-8-20/h4-10,15,18H,11-14H2,1-3H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | NTIHNCWRYTUDMJ-SFHVURJKSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |