C24H31NO3 — CID 100723506
N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-phenyloxane-4-carboxamide (PubChem CID 100723506) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 100723506 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-phenyloxane-4-carboxamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NC(=O)C2(c3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-18(2)17-22(19-9-11-21(27-3)12-10-19)25-23(26)24(13-15-28-16-14-24)20-7-5-4-6-8-20/h4-12,18,22H,13-17H2,1-3H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | QDYXWKBKHBKHNF-JOCHJYFZSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |