C23H29NO3 — CID 4250680
4-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide (PubChem CID 4250680) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 4250680 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NC(C)CCc3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C23H29NO3/c1-18(8-9-19-6-4-3-5-7-19)24-22(25)23(14-16-27-17-15-23)20-10-12-21(26-2)13-11-20/h3-7,10-13,18H,8-9,14-17H2,1-2H3,(H,24,25) |
| InChIKey | RTTIADAELZDHCN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |