C24H31NO4 — CID 42648874
4-(3,4-dimethoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide (PubChem CID 42648874) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 42648874 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(4-phenylbutan-2-yl)oxane-4-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NC(C)CCc3ccccc3)CCOCC2)cc1OC |
| InChI | InChI=1S/C24H31NO4/c1-18(9-10-19-7-5-4-6-8-19)25-23(26)24(13-15-29-16-14-24)20-11-12-21(27-2)22(17-20)28-3/h4-8,11-12,17-18H,9-10,13-16H2,1-3H3,(H,25,26) |
| InChIKey | OEJXXJQMKRMWLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |