C20H22BrNO4 — CID 29134635
N-(4-bromophenyl)-4-(3,4-dimethoxyphenyl)oxane-4-carboxamide (PubChem CID 29134635) has the molecular formula C20H22BrNO4 and a molecular weight of 420.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(3,4-dimethoxyphenyl)oxane-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-(3,4-dimethoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 29134635 |
| Molecular Formula | C20H22BrNO4 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-(4-bromophenyl)-4-(3,4-dimethoxyphenyl)oxane-4-carboxamide |
| SMILES | COc1ccc(C2(C(=O)Nc3ccc(Br)cc3)CCOCC2)cc1OC |
| InChI | InChI=1S/C20H22BrNO4/c1-24-17-8-3-14(13-18(17)25-2)20(9-11-26-12-10-20)19(23)22-16-6-4-15(21)5-7-16/h3-8,13H,9-12H2,1-2H3,(H,22,23) |
| InChIKey | LNIGBNUHHCWCDB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |