C20H21NO4 — CID 110438984
N-(4-acetylphenyl)-1-(3,4-dimethoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 110438984) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1-(3,4-dimethoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1-(3,4-dimethoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110438984 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(4-acetylphenyl)-1-(3,4-dimethoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)Nc3ccc(C(C)=O)cc3)CC2)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-13(22)14-4-7-16(8-5-14)21-19(23)20(10-11-20)15-6-9-17(24-2)18(12-15)25-3/h4-9,12H,10-11H2,1-3H3,(H,21,23) |
| InChIKey | ILDGGAVVAZGNIO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |