C24H26N2O3 — CID 90958377
1-(3,4-dimethoxyphenyl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclopropane-1-carboxamide (PubChem CID 90958377) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90958377 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)Nc3ccc4[nH]c5c(c4c3)CCCC5)CC2)cc1OC |
| InChI | InChI=1S/C24H26N2O3/c1-28-21-10-7-15(13-22(21)29-2)24(11-12-24)23(27)25-16-8-9-20-18(14-16)17-5-3-4-6-19(17)26-20/h7-10,13-14,26H,3-6,11-12H2,1-2H3,(H,25,27) |
| InChIKey | IOHKUTNOTOSNNG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|