C19H21FN2O3 — CID 119419472
N-(3-amino-4-methoxyphenyl)-4-(3-fluorophenyl)oxane-4-carboxamide (PubChem CID 119419472) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-(3-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-(3-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 119419472 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-(3-fluorophenyl)oxane-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3cccc(F)c3)CCOCC2)cc1N |
| InChI | InChI=1S/C19H21FN2O3/c1-24-17-6-5-15(12-16(17)21)22-18(23)19(7-9-25-10-8-19)13-3-2-4-14(20)11-13/h2-6,11-12H,7-10,21H2,1H3,(H,22,23) |
| InChIKey | LBFZKQRQDDJDLZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|