C20H19F4NO2 — CID 60582725
4-(3-fluorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]oxane-4-carboxamide (PubChem CID 60582725) has the molecular formula C20H19F4NO2 and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 60582725 |
| Molecular Formula | C20H19F4NO2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]oxane-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3cccc(F)c3)CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19F4NO2/c1-13-5-6-16(12-17(13)20(22,23)24)25-18(26)19(7-9-27-10-8-19)14-3-2-4-15(21)11-14/h2-6,11-12H,7-10H2,1H3,(H,25,26) |
| InChIKey | LVZZIQUHJJWVCQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |