C21H25FN2O2 — CID 60582638
N-[4-(dimethylamino)-3-methylphenyl]-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 60582638) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-methylphenyl]-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3-methylphenyl]-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 60582638 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[4-(dimethylamino)-3-methylphenyl]-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(c3ccc(F)cc3)CCOCC2)ccc1N(C)C |
| InChI | InChI=1S/C21H25FN2O2/c1-15-14-18(8-9-19(15)24(2)3)23-20(25)21(10-12-26-13-11-21)16-4-6-17(22)7-5-16/h4-9,14H,10-13H2,1-3H3,(H,23,25) |
| InChIKey | WMGBURVEUQDXBR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|